|
| 2-Chloro-5-nitropyrimidine Basic information |
| 2-Chloro-5-nitropyrimidine Chemical Properties |
Melting point | 105-110 °C | Boiling point | 345.4±15.0 °C(Predicted) | density | 1.600±0.06 g/cm3(Predicted) | storage temp. | -20°C | form | powder to crystal | pka | -4.60±0.22(Predicted) | color | Light orange to Yellow to Green | InChI | InChI=1S/C4H2ClN3O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H | InChIKey | OFCBNMYNAHUDGE-UHFFFAOYSA-N | SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=N1 | CAS DataBase Reference | 10320-42-0(CAS DataBase Reference) |
| 2-Chloro-5-nitropyrimidine Usage And Synthesis |
Chemical Properties | Light yellow solid |
| 2-Chloro-5-nitropyrimidine Preparation Products And Raw materials |
|