|
|
| | methyl 2,4-dihydroxy-6-pentylbenzoate Basic information |
| Product Name: | methyl 2,4-dihydroxy-6-pentylbenzoate | | Synonyms: | methyl 2,4-dihydroxy-6-pentylbenzoate;methyl 2,4-dihydroxy-6-pentylbenzoate58016-28-7;Olivetol Methyl Ester;Methyl olivetolate Other Name Methyl 2,4-dihydroxy-6-pentylbenzoate;Benzoic acid, 2,4-dihydroxy-6-pentyl-, methyl ester;Methyl olivetolate;CanbidiolImpurity1;Benzoylchloride,4-chloro-5-fluoro- | | CAS: | 58016-28-7 | | MF: | C13H18O4 | | MW: | 238.28 | | EINECS: | | | Product Categories: | | | Mol File: | 58016-28-7.mol |  |
| | methyl 2,4-dihydroxy-6-pentylbenzoate Chemical Properties |
| Melting point | 105-106 °C(Solv: benzene (71-43-2)) | | Boiling point | 409.3±30.0 °C(Predicted) | | density | 1.153±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Dichloromethane; Ethyl Acetate | | form | Solid | | pka | 8.30±0.23(Predicted) | | color | Yellow | | InChI | InChI=1S/C13H18O4/c1-3-4-5-6-9-7-10(14)8-11(15)12(9)13(16)17-2/h7-8,14-15H,3-6H2,1-2H3 | | InChIKey | RQGAOBDPFOADCM-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=C(CCCCC)C=C(O)C=C1O |
| | methyl 2,4-dihydroxy-6-pentylbenzoate Usage And Synthesis |
| Description | methyl 2,4-dihydroxy-6-pentylbenzoate is an organosynthetic intermediate compound used as a biological precursor for the synthesis of delta-9-tetrahydrocannabinol (THC). It has antibacterial properties against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens. | | Uses | Methyl Olivetolate is an intermediate in synthesizing Δ9-Tetrahydrocannabinolic Acid (Acid A & B) (T293235). It is one of the substances screened for in meconium drug testings for medicinal opiods among addicted mothers. Δ9-Tetrahydrocannabinolic Acid has been shown to protect dopaminergic neurons against 1-methyl-4-Ph pyridinium (MPP+) induced cell death. | | Synthesis Reference(s) | Tetrahedron Letters, 23, p. 2935, 1982 DOI: 10.1016/S0040-4039(00)87498-5 |
| | methyl 2,4-dihydroxy-6-pentylbenzoate Preparation Products And Raw materials |
|