- 3,5-Dimethyl-1-adamantanol
-
- $50.00 / 1KG
-
2023-12-23
- CAS:707-37-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 3,5-Dimethyl-1-adamantanol Basic information |
| Product Name: | 3,5-Dimethyl-1-adamantanol | | Synonyms: | 3,5-DIMETHYL-1-ADAMANTANOL;AKOS BC-0635;1-Hydroxy-3,5-dimethyladamantane;1,3-Dimethyl-5-hydroxyadamantane;1,3-DiMethyl-5-adaMantanol;3,5-DiMethyl-1-hydroxyadaMantane;3,5-DiMethyltricyclo[3.3.1.13,7]decan-1-ol;NSC 102294 | | CAS: | 707-37-9 | | MF: | C12H20O | | MW: | 180.29 | | EINECS: | 615-150-8 | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Adamantanes;Adamantane derivatives | | Mol File: | 707-37-9.mol |  |
| | 3,5-Dimethyl-1-adamantanol Chemical Properties |
| Melting point | 95 °C | | Boiling point | 247.2±8.0 °C(Predicted) | | density | 1.121±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 15.41±0.60(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C12H20O/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9,13H,3-8H2,1-2H3 | | InChIKey | LBWCITVBZLTEKW-UHFFFAOYSA-N | | SMILES | C12(O)CC3(C)CC(CC(C)(C3)C1)C2 |
| HazardClass | IRRITANT | | HS Code | 2902190000 |
| | 3,5-Dimethyl-1-adamantanol Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 3,5-Dimethyl-1-adamantanol is an impurity of Memantine (M218000). Memantine impurity B. Memantine USP Related Compound B (3,5-Dimethyladamantane-1-ol). |
| | 3,5-Dimethyl-1-adamantanol Preparation Products And Raw materials |
|