- 2-Chloro-4-picoline
-
- $10.00 / 1kg
-
2024-12-20
- CAS:3678-62-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20 ton
- 2-Chloro-4-picoline
-
- $0.00 / 1kg
-
2024-10-25
- CAS:3678-62-4
- Min. Order: 1kg
- Purity: 98.00%
- Supply Ability: 100tons
|
| | 2-Chloro-4-picoline Basic information |
| | 2-Chloro-4-picoline Chemical Properties |
| Melting point | 115°C | | Boiling point | 194-195 °C (lit.) | | density | 1.142 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.529(lit.) | | Fp | 193 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Liquid | | pka | 0.94±0.10(Predicted) | | Specific Gravity | 1.14 | | color | Clear colorless to light yellow | | InChI | InChI=1S/C6H6ClN/c1-5-2-3-8-6(7)4-5/h2-4H,1H3 | | InChIKey | MZVSTDHRRYQFGI-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=CC(C)=C1 | | CAS DataBase Reference | 3678-62-4(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Cl-4-(CH3)-pyridine(3678-62-4) |
| | 2-Chloro-4-picoline Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid. | | Uses | 2-Chloro-4-methylpyridine is used as a reagent in the synthesis of the mGLUR5 modulators imidazolyl-ethynyl-pyridines as potential antipsychotics. It is also used in the preparation of trifluoromethyl(pyrimidinyl)azetidinecarboxamides as potent, orally bioavailable TGR5 agonists. | | General Description | 2-Chloro-4-methylpyridine (2-Chloro-4-picoline) reacts with 3,5-bis(trifluoromethyl)phenylboronic acid to form 2-(3,5-bis(trifluoromethyl)phenyl)-4-methylpyridine by palladium-catalyzed cross-coupling reaction. |
| | 2-Chloro-4-picoline Preparation Products And Raw materials |
|