|
|
| | 4-METHYLBUTYROPHENONE Basic information |
| Product Name: | 4-METHYLBUTYROPHENONE | | Synonyms: | 1-Butanone, 1-(4-methylphenyl)-;Butyrophenone, 4'-methyl-;4-METHYLBUTYROPHENONE;P-METHYLBUTYROPHENONE;4-Butyryltoluene;1-(4-methylphenyl)butan-1-one;1-(4-Methylphenyl)-1-butanone;1-p-tolylbutan-1-one | | CAS: | 4160-52-5 | | MF: | C11H14O | | MW: | 162.23 | | EINECS: | 223-996-0 | | Product Categories: | | | Mol File: | 4160-52-5.mol |  |
| | 4-METHYLBUTYROPHENONE Chemical Properties |
| Melting point | 12℃ | | Boiling point | 252℃ (739 Torr) | | density | 0.952±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.5232 (589.3 nm 20℃) | | Fp | 110.1±8.8℃ | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Oil | | color | Clear Colourless | | InChI | InChI=1S/C11H14O/c1-3-4-11(12)10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3 | | InChIKey | CIYAESDXUTVTAL-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)C=C1)(=O)CCC |
| | 4-METHYLBUTYROPHENONE Usage And Synthesis |
| Uses | 4''-Methylbutyrophenone is an aryl alkyl ketone used in the quenching of chemically excited acetone phosphorescence. | | Uses | 4'-Methylbutyrophenone is an aryl alkyl ketone used in the quenching of chemically excited acetone phosphorescence. |
| | 4-METHYLBUTYROPHENONE Preparation Products And Raw materials |
|