|
|
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Basic information | | Uses |
| Product Name: | 2,6-Dibromo-4-(trifluoromethoxy)aniline | | Synonyms: | 3,5-Dibromo-4-(trifluoromethoxy)aniline;3.5-Dibromo-4-Aminotrifluoromethoxybenzen;3,5-Dibromo-4-Aminotrifluoromethoxy;3,5-DIBROMO-4-AMINOTRIFLUOROMETHOXY BENZENE 99+%;3,5-dibromo-5-AminoTrifluoromethoxybenzene;4-Amino-3,5-dibromotrifluoromethoxybenzene;2,6-Dibromo-4-(trifluoromethoxy)aniline 97%;2,6-Dibromo-4-(trifluoromethoxy)aniline97% | | CAS: | 88149-49-9 | | MF: | C7H4Br2F3NO | | MW: | 334.92 | | EINECS: | 201-805-1 | | Product Categories: | amine| alkyl bromide | | Mol File: | 88149-49-9.mol |  |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Chemical Properties |
| Melting point | 70-74 °C(lit.) | | Boiling point | 65/0.1mm | | density | 2.036±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | -0.38±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C7H4Br2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 | | InChIKey | JBSWOEGXMADXOU-UHFFFAOYSA-N | | SMILES | C1(N)=C(Br)C=C(OC(F)(F)F)C=C1Br | | CAS DataBase Reference | 88149-49-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-60-37 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29222990 |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Usage And Synthesis |
| Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. | | Chemical Properties | Light pink powder | | Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. |
| | 2,6-Dibromo-4-(trifluoromethoxy)aniline Preparation Products And Raw materials |
|