|
| 2,6-Dibromo-4-(trifluoromethoxy)aniline Basic information | Uses |
Product Name: | 2,6-Dibromo-4-(trifluoromethoxy)aniline | Synonyms: | 3,5-Dibromo-4-(trifluoromethoxy)aniline;3.5-Dibromo-4-Aminotrifluoromethoxybenzen;3,5-Dibromo-4-Aminotrifluoromethoxy;3,5-DIBROMO-4-AMINOTRIFLUOROMETHOXY BENZENE 99+%;3,5-dibromo-5-AminoTrifluoromethoxybenzene;4-Amino-3,5-dibromotrifluoromethoxybenzene;2,6-Dibromo-4-(trifluoromethoxy)aniline 97%;2,6-Dibromo-4-(trifluoromethoxy)aniline97% | CAS: | 88149-49-9 | MF: | C7H4Br2F3NO | MW: | 334.92 | EINECS: | 201-805-1 | Product Categories: | amine| alkyl bromide | Mol File: | 88149-49-9.mol | ![2,6-Dibromo-4-(trifluoromethoxy)aniline Structure](CAS/GIF/88149-49-9.gif) |
| 2,6-Dibromo-4-(trifluoromethoxy)aniline Chemical Properties |
Melting point | 70-74 °C(lit.) | Boiling point | 65/0.1mm | density | 2.036±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | solubility | DMSO (Slightly), Methanol (Slightly) | form | Solid | pka | -0.38±0.10(Predicted) | color | White to Off-White | InChI | InChI=1S/C7H4Br2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 | InChIKey | JBSWOEGXMADXOU-UHFFFAOYSA-N | SMILES | C1(N)=C(Br)C=C(OC(F)(F)F)C=C1Br | CAS DataBase Reference | 88149-49-9(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36-60-37 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29222990 |
| 2,6-Dibromo-4-(trifluoromethoxy)aniline Usage And Synthesis |
Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. | Chemical Properties | Light pink powder | Uses | 2,6-Dibromo-4-(trifluoromethoxy)benzenamine is used in the synthesis of novel pyridylpyrazole acid derivatives in the preparation of agricultural insecticides. |
| 2,6-Dibromo-4-(trifluoromethoxy)aniline Preparation Products And Raw materials |
|