|
| 1-(4-Hydroxyphenyl)piperazine Basic information |
| 1-(4-Hydroxyphenyl)piperazine Chemical Properties |
Melting point | 220 °C | Boiling point | 371.3±27.0 °C(Predicted) | density | 1.141±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | solubility | DMSO (Slightly), Methanol (Slightly) | form | Powder | pka | 12.18±0.30(Predicted) | color | Brownish | BRN | 150964 | InChI | InChI=1S/C10H14N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2 | InChIKey | GPEOAEVZTOQXLG-UHFFFAOYSA-N | SMILES | C1(O)=CC=C(N2CCNCC2)C=C1 | LogP | 0.374 | CAS DataBase Reference | 56621-48-8(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36 | RIDADR | UN3263 | WGK Germany | 3 | F | 10-34 | Hazard Note | Irritant | HazardClass | 8 | PackingGroup | III | HS Code | 29335990 |
| 1-(4-Hydroxyphenyl)piperazine Usage And Synthesis |
Chemical Properties | brownish powder |
| 1-(4-Hydroxyphenyl)piperazine Preparation Products And Raw materials |
|