- 5-Fluoro-2-iodobenzoic acid
-
- $5.00 / 1KG
-
2024-04-09
- CAS:52548-63-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 5-Fluoro-2-iodobenzoic acid Basic information |
| | 5-Fluoro-2-iodobenzoic acid Chemical Properties |
| Melting point | 145-149 °C | | Boiling point | 307.9±27.0 °C(Predicted) | | density | 2.074±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 2.52±0.10(Predicted) | | color | White to Light yellow to Light orange | | Sensitive | Light Sensitive | | InChI | InChI=1S/C7H4FIO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) | | InChIKey | XPFMQYOPTHMSJJ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(F)=CC=C1I |
| Hazard Codes | T | | Risk Statements | 25-36/37/38 | | Safety Statements | 26-45 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | Ⅲ | | HS Code | 2916310090 |
| | 5-Fluoro-2-iodobenzoic acid Usage And Synthesis |
| Uses | 5-Fluoro-2-iodobenzoic acid is an important intermediate for the production of pharmaceuticals and agrochemicals. |
| | 5-Fluoro-2-iodobenzoic acid Preparation Products And Raw materials |
|