|
|
| | Methyl 2-bromomethyl-3-nitrobenzoate Basic information |
| Product Name: | Methyl 2-bromomethyl-3-nitrobenzoate | | Synonyms: | 2-Bromomethyl-3-NitrobenzoicAcidMethylEster;Methyl 2-bromomethyl-3-nitrobenzoate;Methyl 2-bromomethyl;2-BroMoMethyl-3-nitrobenzoate Methyl ester;Benzoic acid, 2-(broMoMethyl)-3-nitro-, Methyl ester;2-Bromomethyl-3-nitro-benzoic acid;METHYL-2-BROMOMETHYL-3-NITROBENZONATE;Methyl 2-(bromomethyl)-3-nitrobenzoate 95% | | CAS: | 98475-07-1 | | MF: | C9H8BrNO4 | | MW: | 274.07 | | EINECS: | 619-354-8 | | Product Categories: | Aromatics;Miscellaneous Reagents;1 | | Mol File: | 98475-07-1.mol |  |
| | Methyl 2-bromomethyl-3-nitrobenzoate Chemical Properties |
| Melting point | 72-74° | | Boiling point | 370.9±32.0 °C(Predicted) | | density | 1.624±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | Solid | | color | White to Light yellow | | InChI | InChI=1S/C9H8BrNO4/c1-15-9(12)6-3-2-4-8(11(13)14)7(6)5-10/h2-4H,5H2,1H3 | | InChIKey | FCGIVHSBEKGQMZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC=CC([N+]([O-])=O)=C1CBr |
| RIDADR | UN 3261 8/PG III | | HazardClass | IRRITANT | | HazardClass | 8 | | PackingGroup | III | | HS Code | 2916310090 |
| | Methyl 2-bromomethyl-3-nitrobenzoate Usage And Synthesis |
| Description | Methyl 2-bromomethyl-3-nitrobenzoate is a white or light yellow solid under normal temperature and pressure. It is insoluble in water but soluble in alcoholic organic solvents. It is an organic ester derivative that can be used as an organic synthesis intermediate and a raw material for pharmaceutical chemical synthesis. It is a crucial synthesis intermediate for the drug molecule lenalidomide. Lenalidomide is an antineoplastic drug. The ester group and benzyl bromide unit in the Methyl 2-bromomethyl-3-nitrobenzoate structure are easily convertible functional groups. Its structure contains a strong electron-attracting nitro group and an easily leaving bromine atom. The nitro group is a strong electron-withdrawing group that can increase the reactivity of molecules through conjugation effects and electron attraction. Due to these properties, it has wide applications in organic synthesis transformations. | | Chemical Properties | Pale Yellow Solid |
| | Methyl 2-bromomethyl-3-nitrobenzoate Preparation Products And Raw materials |
|