Tecovirimat manufacturers
- Tecovirimat
-
- $1.00 / 1g
-
2024-09-14
- CAS:816458-31-8
- Min. Order: 1g
- Purity: 99
- Supply Ability: 1000
- Tecovirimat
-
- $0.00 / 1kgkg
-
2024-09-14
- CAS:816458-31-8
- Min. Order: 1kgkg
- Purity: 99%
- Supply Ability: 3000kg
- Tecovirimat
-
- $0.00 / 1g
-
2024-03-12
- CAS:816458-31-8
- Min. Order: 1g
- Purity: 98% HPLC
- Supply Ability: 1kg
|
| | Tecovirimat Basic information |
| Product Name: | Tecovirimat | | Synonyms: | tecovirimat;Tecovirimat USP/EP/BP;rel-N-[(3aR,4R,4aR,5aS,6S,6aS)-3,3a,4,4a,5,5a,6,6a-Octahydro-1,3-dioxo-4,6-ethenocycloprop[f]isoindol-2(1H)-yl]-4-(trifluoromethyl)benzamide;Special Kao Wei Rui | | CAS: | 816458-31-8 | | MF: | C19H15F3N2O3 | | MW: | 376.332 | | EINECS: | | | Product Categories: | API | | Mol File: | 816458-31-8.mol |  |
| | Tecovirimat Chemical Properties |
| Melting point | 194-195 ºC | | density | 1.53 | | storage temp. | -20°C Freezer | | solubility | Dichloromethane (Slightly), DMSO Slightly() | | form | Solid | | color | White to Off-White | | InChI | InChI=1/C19H15F3N2O3/c20-19(21,22)9-3-1-8(2-4-9)16(25)23-24-17(26)14-10-5-6-11(13-7-12(10)13)15(14)18(24)27/h1-6,10-15H,7H2,(H,23,25)/t10-,11+,12+,13-,14-,15+ | | InChIKey | CSKDFZIMJXRJGH-VWLPUNTINA-N | | SMILES | C(F)(C1C=CC(=CC=1)C(=O)NN1C(=O)[C@@]2([H])[C@@]([H])(C1=O)[C@@]1([H])C=C[C@]2([H])[C@]2([H])C[C@]12[H])(F)F |&1:14,16,20,24,26,29,r| |
| | Tecovirimat Usage And Synthesis |
| Uses | Tecovirimat is an orally bioavailable antipoxvirus compound inhibits extracellular virus formation and protects mice from lethal orthopoxvirus, including vaccinia, monkeypox, camelpox, cowpox, ectromelia (mousepox), and variola viruses. |
| | Tecovirimat Preparation Products And Raw materials |
|