Company Name: |
Chem-Impex International, Inc.
|
Tel: |
800 869-9290 US and Canada only |
Email: |
|
Products Intro: |
CAS:114290-82-3 Package:25MG/$60.00;100MG/$110.00;250MG/$215.00;1G/$430.00
|
|
| BOC-PHE-(R)-PHE-OH Basic information |
Product Name: | BOC-PHE-(R)-PHE-OH | Synonyms: | BOC-PHE-PSI(CH2NH)-PHE-OH;BOC-PHE-Y(CH2NH)-PHE-OH;BOC-PHE-(R)-PHE-OH;RARECHEM EM WB 0264;Boc-Phe-ψ(CH2NH)-Phe-OH;((S)-2-((tert-butoxycarbonyl)amino)-3-phenylpropyl)-L-phenylalanine;L-Phenylalanine, N-[2-[[(1,1-dimethylethoxy)carbonyl]amino]-3-phenylpropyl]-, (S)- (9CI) | CAS: | 114290-82-3 | MF: | C23H30N2O4 | MW: | 398.5 | EINECS: | | Product Categories: | | Mol File: | 114290-82-3.mol | ![BOC-PHE-(R)-PHE-OH Structure](CAS/GIF/114290-82-3.gif) |
| BOC-PHE-(R)-PHE-OH Chemical Properties |
Boiling point | 589.0±50.0 °C(Predicted) | density | 1.144±0.06 g/cm3(Predicted) | storage temp. | -15°C | pka | 2.17±0.10(Predicted) |
| BOC-PHE-(R)-PHE-OH Usage And Synthesis |
| BOC-PHE-(R)-PHE-OH Preparation Products And Raw materials |
|