|
|
| | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile Basic information |
| Product Name: | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile | | Synonyms: | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile;TAK-438( Vonoprazan fumarate) intermediate 2;1H-Pyrrole-3-carbonitrile,5-(2-fluorophenyl)-;Vonoprazan Fumarate impurity B;TAK438 Impurity 19;Vonoprazan impurity 32/5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile;Vonoprazan impurity SM2-I: 3-nitrile;Vonoprazan-4 | | CAS: | 1240948-77-9 | | MF: | C11H7FN2 | | MW: | 186.19 | | EINECS: | 809-912-0 | | Product Categories: | 1240948-77-9 | | Mol File: | 1240948-77-9.mol |  |
| | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile Chemical Properties |
| Boiling point | 364.7±32.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 13.87±0.50(Predicted) | | form | Solid | | Dielectric constant | 5.5（22.0℃） | | InChI | InChI=1S/C11H7FN2/c12-10-4-2-1-3-9(10)11-5-8(6-13)7-14-11/h1-5,7,14H | | InChIKey | ZDEFHFJZEDEKJO-UHFFFAOYSA-N | | SMILES | N1C(C2=CC=CC=C2F)=CC(C#N)=C1 |
| | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile Usage And Synthesis |
| Description | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile is an important pharmaceutical intermediate component for the preparation of vonorasan fumarate, vonoprazan key intermediate, and vorexanol fumarate intermediate. | | Uses | 5-(2-Fluorophenyl)-1H-pyrrole-3-carbonitrile is an impurity of Vonoprazan (V767010) a novel potassium-competitive acid blocker for the treatment of acid-related diseases. |
| | 5-(2-fluorophenyl)-1H-pyrrole-3-carbonitrile Preparation Products And Raw materials |
|