|
|
| | ICA-105574 Basic information |
| Product Name: | ICA-105574 | | Synonyms: | 3-nitro-N-(4-phenoxyphenyl)-benzamide;ICA-105574;Benzamide, 3-nitro-N-(4-phenoxyphenyl)-;activator,KcsA,current amplitudes,ICA105574,ICA-105574,ICA 105574,Potassium Channel,inhibit,Inhibitor,hERG channel | | CAS: | 316146-57-3 | | MF: | C19H14N2O4 | | MW: | 334.33 | | EINECS: | | | Product Categories: | | | Mol File: | 316146-57-3.mol |  |
| | ICA-105574 Chemical Properties |
| Boiling point | 430.9±30.0 °C(Predicted) | | density | 1.333±0.06 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMSO: >20mg/mL | | pka | 11.76±0.70(Predicted) | | form | Solid | | color | off-white to light tan | | InChI | InChI=1S/C19H14N2O4/c22-19(14-5-4-6-16(13-14)21(23)24)20-15-9-11-18(12-10-15)25-17-7-2-1-3-8-17/h1-13H,(H,20,22) | | InChIKey | GDWKBKTVROCPNZ-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(OC2=CC=CC=C2)C=C1)(=O)C1=CC=CC([N+]([O-])=O)=C1 |
| | ICA-105574 Usage And Synthesis |
| Description |
ICA-105574 is a potent and efficacious hERG channel activator. The primary mechanism by which ICA-105574 potentiates hERG channel activity is by removing hERG channel inactivation. ICA-105574 steeply potentiates current amplitudes more than 10-fold with an EC50 value of 0.5 +/- 0.1 μM and a Hill slope (n(H)) of 3.3 +/- 0.2. ICA-105574 shifts the voltage dependence of Ptype inactivation to a very positive direction and removes the hERG channel from inactivation at physiological membrane potentials[1].
| | References |
[1] Mahoko Asayama . “Effects of an hERG Activator, ICA-105574, on Electrophysiological Properties of Canine Hearts.” Journal of pharmacological sciences 121 1 (2013): Pages 1-8.
|
| | ICA-105574 Preparation Products And Raw materials |
|