|
|
| | 7-Chloro-2-methylquinoline Basic information |
| | 7-Chloro-2-methylquinoline Chemical Properties |
| Melting point | 74-78 °C (lit.) | | Boiling point | 87 °C / 0.5mmHg | | density | 1.1810 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.25±0.50(Predicted) | | color | Pale Yellow to Light Beige | | BRN | 115318 | | InChI | InChI=1S/C10H8ClN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3 | | InChIKey | WQZQFYRSYLXBGP-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C(Cl)C=2)C=CC=1C | | CAS DataBase Reference | 4965-33-7(CAS DataBase Reference) | | NIST Chemistry Reference | Quinoline, 7-chloro-2-methyl-(4965-33-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29334900 |
| | 7-Chloro-2-methylquinoline Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 7-Chloroquinaldine is used as the starting material in the synthesis of (E)-1-[3-[2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-2-propen-1-ol (C381415); an intermediate in the synthesis of the antiasthmatic, Montelukast Sodium Salt (M568000). |
| | 7-Chloro-2-methylquinoline Preparation Products And Raw materials |
|