|
| 4-chloro-7-fluoro-quinazoline Basic information |
| 4-chloro-7-fluoro-quinazoline Chemical Properties |
Boiling point | 284.9±20.0 °C(Predicted) | density | 1.447 | refractive index | 1.635 | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | pka | 0.35±0.30(Predicted) | InChI | InChI=1S/C8H4ClFN2/c9-8-6-2-1-5(10)3-7(6)11-4-12-8/h1-4H | InChIKey | JHBYQJRHJVEKPK-UHFFFAOYSA-N | SMILES | N1=C2C(C=CC(F)=C2)=C(Cl)N=C1 |
HazardClass | IRRITANT | HS Code | 2933998090 |
| 4-chloro-7-fluoro-quinazoline Usage And Synthesis |
Description | 4-chloro-7-fluoro-quinazoline is a white crystalline solid. It can be dissolved in organic solvents such as ethanol and dimethylformamide. |
| 4-chloro-7-fluoro-quinazoline Preparation Products And Raw materials |
|