|
| 4-Bromo-1-methylpyrazole Basic information |
| 4-Bromo-1-methylpyrazole Chemical Properties |
Boiling point | 185-188°C | density | 1.558 | refractive index | n20/D 1.531 | Fp | 93°C | storage temp. | Sealed in dry,Room Temperature | form | Liquid | pka | 0.21±0.10(Predicted) | color | Colorless to pale yellow | InChI | InChI=1S/C4H5BrN2/c1-7-3-4(5)2-6-7/h2-3H,1H3 | InChIKey | IXJSDKIJPVSPKF-UHFFFAOYSA-N | SMILES | N1(C)C=C(Br)C=N1 | CAS DataBase Reference | 15803-02-8(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 37/38-41 | Safety Statements | 26-39 | RIDADR | UN1760 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29331990 |
| 4-Bromo-1-methylpyrazole Usage And Synthesis |
Uses | 4-Bromo-1-methylpyrazole is a colourless or light yellow liquid at room temperature and pressure. It can be used as an intermediate in organic synthesis. It has good solubility in common organic solvents such as ethyl acetate, dichloromethane, dimethyl sulfoxide, and N, N-dimethylformamide but poor solubility in water. |
| 4-Bromo-1-methylpyrazole Preparation Products And Raw materials |
|