|
| 2-Bromo-1-chloro-4-fluorobenzene Basic information |
| 2-Bromo-1-chloro-4-fluorobenzene Chemical Properties |
Boiling point | 202.1±20.0 °C(Predicted) | density | 1.75 | refractive index | 1.5530 | storage temp. | Sealed in dry,Room Temperature | form | clear liquid | color | Colorless to Light yellow to Light orange | InChI | InChI=1S/C6H3BrClF/c7-5-3-4(9)1-2-6(5)8/h1-3H | InChIKey | FOCCSIJMXBTKHD-UHFFFAOYSA-N | SMILES | C1(Cl)=CC=C(F)C=C1Br | CAS DataBase Reference | 201849-15-2(CAS DataBase Reference) |
Provider | Language |
ALFA
| English |
| 2-Bromo-1-chloro-4-fluorobenzene Usage And Synthesis |
| 2-Bromo-1-chloro-4-fluorobenzene Preparation Products And Raw materials |
|