|
|
| | 1,3-Benzodioxole-5-acetic acid methyl ester Basic information |
| | 1,3-Benzodioxole-5-acetic acid methyl ester Chemical Properties |
| Boiling point | 278.3℃ | | density | 1.265 | | refractive index | 1.5430 (estimate) | | Fp | 120.0℃ | | InChI | InChI=1S/C10H10O4/c1-12-10(11)5-7-2-3-8-9(4-7)14-6-13-8/h2-4H,5-6H2,1H3 | | InChIKey | HEMYXNDMAAOTCK-UHFFFAOYSA-N | | SMILES | O1C2=CC=C(CC(OC)=O)C=C2OC1 |
| | 1,3-Benzodioxole-5-acetic acid methyl ester Usage And Synthesis |
| Uses | Methyl 1,3-benzodioxol-5-ylacetate is a reagent used to prepare pharmaceutically active Benzodioxole derivatives. | | Preparation | 1,3-Benzodioxole-5-acetic acid methyl ester is a lignan synthesized by the condensation of podophyllotoxin with acetone in the presence of an acid catalyst. | | Mode of action | 1,3-Benzodioxole-5-acetic acid methyl ester is a regioselective inhibitor of 5α→5β conversion. This inhibition leads to a decrease in the production of diene metabolites that may be carcinogenic, as well as a decrease in the production of podophyllotoxin and its derivatives (podophyllum alkaloids). It has been shown to have anti-inflammatory properties and to inhibit prostaglandin synthesis. |
| | 1,3-Benzodioxole-5-acetic acid methyl ester Preparation Products And Raw materials |
|