Carcinine dihydrochloride manufacturers
|
| | Carcinine dihydrochloride Basic information |
| Product Name: | Carcinine dihydrochloride | | Synonyms: | Propanamide, 3-amino-N-2-(1H-imidazol-4-yl)ethyl-, dihydrochloride;3-Amino-N-[2-(1H-imidazol-4-yl)ethyl]propanamide dihydrochloride;Alistin;N-(2-(1H-Imidazol-5-yl)ethyl)-3-aminopropanamide dihydrochloride;Carcinine DiHCl;Decarboxylation carnosine;Decarboxy Carnosine;Decarboxylated carnosine | | CAS: | 57022-38-5 | | MF: | | | MW: | 0 | | EINECS: | 000-000-0 | | Product Categories: | 11;cosmestic | | Mol File: | 57022-38-5.mol |  |
| | Carcinine dihydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: >15mg/mL | | form | powder | | color | white to beige | | InChI | InChI=1S/C8H14N4O.2ClH/c1-2-11-8(13)6(3-9)7-4-10-5-12-7;;/h4-6H,2-3,9H2,1H3,(H,10,12)(H,11,13);2*1H | | InChIKey | WGTMERJVZVYSBG-UHFFFAOYSA-N | | SMILES | C(NCC)(=O)C(C1=CNC=N1)CN.[H]Cl.[H]Cl |
| | Carcinine dihydrochloride Usage And Synthesis |
| Uses | Carcinine dihydrochloride is a benzylamine derivative produced by the reaction of malic acid with dehydroascorbic acid. It has anti-aging, antioxidant, anti-inflammatory, protective and sunscreen properties. It also protects against premature aging, UV-induced damage and apoptosis. It is commonly used in anti-aging formulations, especially for sensitive skin. In addition, Carcinine dihydrochloride has been used to study its effects on dopaminergic neuronal degeneration. | | Biological Activity | Carcinine dihydrochloride (β-alanyl histamine) is a selective histamine H3 antagonist, 100-1000-fold selective for H3 over H2 and H1, that also functions as an antioxidant and as a chemical chaperone to reduce non-enzymatic glycation of proteins and maintain native folding of proteins.
Carcinine can scavenge a toxic product, called 4-hydroxynonenal (4-HNE), obtained during lipid oxidation. It has a protective role from oxidative damage on photoreceptor cells. Carcinine also exhibits lipid-peroxidase activity. |
| | Carcinine dihydrochloride Preparation Products And Raw materials |
|