|
| Bis(triphenylphosphine)nickel(II) bromide Basic information |
| Bis(triphenylphosphine)nickel(II) bromide Chemical Properties |
Melting point | 219-223 °C (lit.) | storage temp. | Inert atmosphere,Room Temperature | form | crystal | color | green | Exposure limits | NIOSH: IDLH 10 mg/m3; TWA 0.015 mg/m3 | InChI | InChI=1S/2C18H15P.2BrH.Ni/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h2*1-15H;2*1H;/q;;;;+2/p-2 | InChIKey | QEKXARSPUFVXIX-UHFFFAOYSA-L | SMILES | P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1.[Ni](Br)Br | CAS DataBase Reference | 14126-37-5(CAS DataBase Reference) |
Hazard Codes | Xn | Risk Statements | 20/21/22 | Safety Statements | 36/37 | RIDADR | UN 1759 8/PG 2 | WGK Germany | 3 | HazardClass | 6.1(b) | PackingGroup | III | HS Code | 29319090 |
| Bis(triphenylphosphine)nickel(II) bromide Usage And Synthesis |
Chemical Properties | DARK GREEN CRYSTALLINE POWDER OR CRYSTALS | Uses | Catalysts for the cross-coupling reactions, C-X bond reduction, homocoupling of Csp2 halides, displacement of aryl halides, and oligomerization of dienes | Uses | As a polymerization catalyst |
| Bis(triphenylphosphine)nickel(II) bromide Preparation Products And Raw materials |
|