|
| Cytidine-5'-diphosphate disodium salt Basic information |
Product Name: | Cytidine-5'-diphosphate disodium salt | Synonyms: | CYTIDINE-5'-DIPHOSPHATE DISODIUM SALT HEMIHYDRATE;cytidine-5'-diphosphatedisodiumsalthemihydratecrystalline;Cytidine-5'-diphosphate disodium salt;5'-CDPNa2;SodiuM 4-aMino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxyMethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-dihydropyriMidin-5-yl hydrogendiphosphate;Sodium 4-amino-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-2-oxo-1,2-di;Cytidine-5'-diphosphated;Cytidine-5'-diphosphate, disodium | CAS: | 54394-90-0 | MF: | C9H16N3NaO11P2 | MW: | 427.17 | EINECS: | 2017-001-1 | Product Categories: | Material;Pharmaceutical | Mol File: | 54394-90-0.mol |  |
| Cytidine-5'-diphosphate disodium salt Chemical Properties |
form | Powder | color | White to Off-white | InChIKey | MAGSIBHRUIBONY-RFFBCSJBNA-N | SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH] |&1:1,2,3,15,r| |
| Cytidine-5'-diphosphate disodium salt Usage And Synthesis |
Uses | Cytidine-5'-diphosphate disodium salt is a nucleoside diphosphate that acts as a carrier for phosphorylcholine, diacylglycerol, and other molecules during phospholipid synthesis.
| Biosynthesis |
Cytidine-5'-diphosphate disodium salt is a nucleotide that is synthesized in the cytosol.
|
| Cytidine-5'-diphosphate disodium salt Preparation Products And Raw materials |
|