|
|
| | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE Basic information |
| Product Name: | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE | | Synonyms: | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE;2(1H)-Pyridinone, 1-methyl-3,5-dinitro-;1-Methyl-3,5-dinitro-1,2-dihydropyridine-2-one;3,5-Dinitro-1-methyl-2-pyridone;1-Methyl-3,5-dinitropyridine-2;1-Methyl-3,5-dinitro-1H-p...;1-Methyl-3,5-dinitropyridine-2(1H)-one;1-Methyl-3,5-dinitro-1,2-dihydropyridin-2-one | | CAS: | 14150-94-8 | | MF: | C6H5N3O5 | | MW: | 199.12 | | EINECS: | | | Product Categories: | Pyridines;Building Blocks;C6;Chemical Synthesis;Heterocyclic Building Blocks;Heterocycle-Pyridine series | | Mol File: | 14150-94-8.mol |  |
| | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE Chemical Properties |
| Melting point | 174-178℃ | | Boiling point | 289.5±40.0 °C(Predicted) | | density | 1.60 | | storage temp. | Store at 0-8℃ | | pka | -8.36±0.62(Predicted) | | form | powder to crystal | | color | Light orange to Yellow to Green | | λmax | 308nm(H2O)(lit.) | | InChI | InChI=1S/C6H5N3O5/c1-7-3-4(8(11)12)2-5(6(7)10)9(13)14/h2-3H,1H3 | | InChIKey | QARVELJVEBLWGK-UHFFFAOYSA-N | | SMILES | C1(=O)N(C)C=C([N+]([O-])=O)C=C1[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2933399990 |
| | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE Usage And Synthesis |
| Uses | 1-Methyl-3,5-dinitro-1H-pyridin-2-one can be used as an organic synthesis intermediate involved in the efficient synthesis of nitrocyclic ether[b]pyridine. It is also a nucleophilic reagent. It reacts with primary amines to produce carbamates in an efficient way without using reducing agents. The electronic defects of the pyridine cation allow this nucleophilic attack. |
| | 1-METHYL-3,5-DINITRO-1H-PYRIDIN-2-ONE Preparation Products And Raw materials |
|