|
| Methyl 3-hydroxypropanoate Basic information |
Product Name: | Methyl 3-hydroxypropanoate | Synonyms: | 3-hydroxy-propanoicacidmethylester;HOCH2CH2C(O)OCH3;Hydracrylic acid, methyl ester;Methyl beta-hydroxypropionate;Methyl gamma-hydroxypropionate;Methyl hydracrylate;Methyl3-hydroxypropionate;METHYL 3-HYDROXYPROPANOATE | CAS: | 6149-41-3 | MF: | C4H8O3 | MW: | 104.1 | EINECS: | | Product Categories: | ADVANCED INT. | Mol File: | 6149-41-3.mol | ![Methyl 3-hydroxypropanoate Structure](CAS/GIF/6149-41-3.gif) |
| Methyl 3-hydroxypropanoate Chemical Properties |
Melting point | 147-148 °C(Solv: benzene (71-43-2); cyclohexane (110-82-7)) | Boiling point | 179°C (estimate) | density | 1.1050 | refractive index | 1.4300 | storage temp. | 2-8°C | solubility | Chloroform, Methanol | form | Oil | pka | 13.89±0.10(Predicted) | color | Colourless | InChI | InChI=1S/C4H8O3/c1-7-4(6)2-3-5/h5H,2-3H2,1H3 | InChIKey | RVGLEPQPVDUSOJ-UHFFFAOYSA-N | SMILES | C(OC)(=O)CCO |
HazardClass | IRRITANT | HS Code | 2918199890 |
| Methyl 3-hydroxypropanoate Usage And Synthesis |
Definition | ChEBI: 2-Methyl-3-hydroxypropanoate is a 3-hydroxy carboxylic acid. | General Description |
Methyl 3-hydroxypropanoate is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
|
| Methyl 3-hydroxypropanoate Preparation Products And Raw materials |
|