- Tropisetron hydrochloride
-
- $0.00 / 1Kg/Bag
-
2024-11-22
- CAS:105826-92-4
- Min. Order: 1KG
- Purity: 99%-101%,EP
- Supply Ability: 10kg
|
| | Tropisetron hydrochloride Basic information |
| | Tropisetron hydrochloride Chemical Properties |
| Melting point | 283-285°C | | RTECS | NL6012520 | | storage temp. | 2-8°C | | solubility | H2O: >10mg/mL | | form | solid | | color | White to Light yellow | | Water Solubility | Soluble in water | | Merck | 14,9783 | | InChI | InChI=1/C17H20N2O2.ClH/c1-19-11-6-7-12(19)9-13(8-11)21-17(20)15-10-18-16-5-3-2-4-14(15)16;/h2-5,10-13,15H,6-9H2,1H3;1H/t11-,12+,13?,15?; | | InChIKey | ZAOQBEAHJFSJLY-NBVCILBMNA-N | | SMILES | C12C=CC=CC=1N=CC2C(=O)OC1C[C@]2([H])N(C)[C@@]([H])(CC2)C1.Cl |&1:14,18,r| | | CAS DataBase Reference | 105826-92-4(CAS DataBase Reference) |
| RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29399990 | | Toxicity | mouse,LD50,intravenous,37900ug/kg (37.9mg/kg),Gekkan Yakuji. Pharmaceuticals Monthly. Vol. 40, Pg. 2445, 1998. |
| | Tropisetron hydrochloride Usage And Synthesis |
| Chemical Properties | White to Off-White Crystalline Solid | | Uses | A selective 5-HT3 serotonin receptor antagonist | | Uses | Specific serotonin (5-HT3) receptor antagonist. Antiemetic. | | Definition | ChEBI: A hydrochloride obtained by combining equimolar amounts of tropisetron and hydrogen chloride. | | Biological Activity | Potent, orally active 5-HT 3 receptor antagonist. Antiemetic. | | Biochem/physiol Actions | Tropisetron a selective serotonin 5-HT3 receptor antagonist is used mainly as an antiemetic to treat nausea and vomiting following chemotherapy . In the treatment of fibromyalgia syndrome (FMS) tropisetron reduced not only pain perception but also had a favourable effect on cardiac dysfunction during treatment. | | storage | Room temperature (desiccate) |
| | Tropisetron hydrochloride Preparation Products And Raw materials |
|