2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid manufacturers
|
| 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Basic information |
Product Name: | 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid | Synonyms: | 2,2-DIFLUORO-BENZO[1,3]DIOXOLE-5-BORONIC ACID;2,2-difluoro-1,3-benzodioxol-5-yl boronic acid;2,2-Difluoro-1,3-benzodioxole-5-boronic acid;(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)boronic acid;Boronic acid,B-(2,2-difluoro-1,3-benzodioxol-5-yl)-;(2,2-difluoro-2H-1,3-benzodioxol-5-yl)boronic acid;2,2-Difluoro-benzo[1,3]dioxole-5-boronic;(2,2-difluoro-2H-1,3-benzodioxol-5-yl)boronic acid(contains varying amounts of Anhydride) | CAS: | 190903-71-0 | MF: | C7H5BF2O4 | MW: | 201.92 | EINECS: | | Product Categories: | | Mol File: | 190903-71-0.mol | ![2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Structure](CAS/GIF/190903-71-0.gif) |
| 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Chemical Properties |
Boiling point | 288.0±50.0 °C(Predicted) | density | 1.58±0.1 g/cm3(Predicted) | storage temp. | Inert atmosphere,2-8°C | pka | 8.25±0.40(Predicted) | InChI | InChI=1S/C7H5BF2O4/c9-7(10)13-5-2-1-4(8(11)12)3-6(5)14-7/h1-3,11-12H | InChIKey | OTTIPUIRDXSIBG-UHFFFAOYSA-N | SMILES | B(C1=CC=C2OC(F)(F)OC2=C1)(O)O |
Hazard Codes | Xi | Risk Statements | 36 | Safety Statements | 26 | HS Code | 2932990090 |
| 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Usage And Synthesis |
| 2,2-Difluoro-benzo[1,3]dioxole-5-boronic acid Preparation Products And Raw materials |
|