|
|
| | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate Basic information |
| Product Name: | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate | | Synonyms: | 1-BUTYL-METHYLPYRROLIDINIUM TRIFLUOROMETHANESULFONATE;N-butyl-N-MethylpyrrolidiniuM trifluoroacetate;N-butyl,methylpyrrolidinium trifluoroacetate;1-Butyl-1-methylpyrrolidin-1-ium 2,2,2-trifluoroacetate;BMPyrr OTf;PP1,4OTF;[C4MPr]TfS;1-butyl-1-methylpyrrolidin-1-ium:trifluoromethanesulfonate | | CAS: | 367522-96-1 | | MF: | C10H20F3NO3S | | MW: | 291.3309096 | | EINECS: | | | Product Categories: | | | Mol File: | 367522-96-1.mol |  |
| | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate Chemical Properties |
| Melting point | 4°C(lit.) | | density | 1.25 g/cm3 (20℃) | | refractive index | 1.4320 to 1.4360 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | PH | 6 (H2O, 25℃) | | BRN | 9820503 | | InChI | InChI=1S/C9H20N.CHF3O3S/c1-3-4-7-10(2)8-5-6-9-10;2-1(3,4)8(5,6)7/h3-9H2,1-2H3;(H,5,6,7)/q+1;/p-1 | | InChIKey | WZJDNKTZWIOOJE-UHFFFAOYSA-M | | SMILES | S(=O)(=O)([O-])C(F)(F)F.[N+]1(CCCC1)(C)CCCC | | ECW | 4.2 V |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933 99 80 |
| | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate Usage And Synthesis |
| Conductivity | 1.85 mS/cm (24 °C) | | Uses | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate ([BMPy][OTf]) is an ionic liquid that can be used as a solvent in:
- Rhodium-catalyzed regioselective hydroformylation reactions.
- Direct asymmetric aldol condensation reaction.
- Desulfurization of fuels.
- Nucleophilic aromatic substitution reactions.
([BMPy][OTf]) can also be used as an electrolyte in supercapacitor applications. | | Preparation | First, the N, N'-butylmethylpyridinium chloride and potassium trifluoromethanesulfonate are mixed in acetone and reacted for 24 h. The reaction solution is filtered to remove solid impurities. Finally, acetone in the solution is removed by distillation and purified to obtain 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate.
|
| | 1-Butyl-1-methylpyrrolidinium trifluoromethanesulfonate Preparation Products And Raw materials |
|