| Company Name: |
Xiamen Work-For-World Medcine Co., Ltd
|
| Tel: |
15921822462; 15921822462 |
| Email: |
keqingyong@wfwmed.com |
| Products Intro: |
Product Name:Ethyl 2-heptyl-4,6-dihydroxybenzoate
CAS:38862-66-7
Purity:99.0% Package:1Kg;10Kg;200Kg
|
ethyl 2-heptyl-4,6-dihydroxybenzoate manufacturers
|
| | ethyl 2-heptyl-4,6-dihydroxybenzoate Basic information |
| | ethyl 2-heptyl-4,6-dihydroxybenzoate Chemical Properties |
| Boiling point | 443.4±30.0 °C(Predicted) | | density | 1.094±0.06 g/cm3(Predicted) | | pka | 8.28±0.23(Predicted) | | InChI | InChI=1S/C16H24O4/c1-3-5-6-7-8-9-12-10-13(17)11-14(18)15(12)16(19)20-4-2/h10-11,17-18H,3-9H2,1-2H3 | | InChIKey | ZKDFAIJIDPUSIY-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=C(O)C=C(O)C=C1CCCCCCC |
| | ethyl 2-heptyl-4,6-dihydroxybenzoate Usage And Synthesis |
| Uses | Ethyl 2-heptyl-4,6-dihydroxybenzoate is an important organic compound with diverse applications. It is widely used in various industries, including the production of polymers, pharmaceuticals, and food preservatives. In the pharmaceutical industry, ethyl 2-heptyl-4,6-dihydroxybenzoate is useful for acting as a preservative. It prevents bacterial growth and extends the shelf life of drugs and other pharmaceutical products. It is also used as an intermediate in synthesizing certain antibiotics, such as erythromycin. |
| | ethyl 2-heptyl-4,6-dihydroxybenzoate Preparation Products And Raw materials |
|