|
|
| | 1-Aminocyclobutanecarboxylic Acid Hydrochloride Basic information |
| | 1-Aminocyclobutanecarboxylic Acid Hydrochloride Chemical Properties |
| Melting point | 226 °C | | RTECS | GU1336000 | | storage temp. | Inert atmosphere,2-8°C | | Water Solubility | Soluble in water | | form | Powder | | color | White to Almost white | | InChI | InChI=1S/C5H9NO2.ClH/c6-5(4(7)8)2-1-3-5;/h1-3,6H2,(H,7,8);1H | | InChIKey | HBTVGNDTGRUBQO-UHFFFAOYSA-N | | SMILES | C1(N)(C(O)=O)CCC1.[H]Cl |
| | 1-Aminocyclobutanecarboxylic Acid Hydrochloride Usage And Synthesis |
| Uses | NMDA receptor antagonist acting at the glycine site | | Application |
1-Aminocyclobutanecarboxylic Acid Hydrochloride is an essential organic synthesis reagent with good chemical stability and ease of use. It is widely used in organic synthesis and medicinal chemistry, helping to prepare complex organic molecules, including peptide chains, drugs, and four-membered ring bioactive molecules. This substance can be used in synthesizing polypeptides and can be used to activate amino acids to form peptide bonds. It is widely used in pharmaceutical synthesis to synthesize drug intermediates, especially drug molecules containing amino acid residues. It can be used to construct the skeleton structure of biologically active molecules.
|
| | 1-Aminocyclobutanecarboxylic Acid Hydrochloride Preparation Products And Raw materials |
|