|
|
| | 3-Amino-4-pyrazolecarbonitrile Basic information |
| | 3-Amino-4-pyrazolecarbonitrile Chemical Properties |
| Melting point | 172-174 °C(lit.) | | Boiling point | 192.71°C (rough estimate) | | density | 1.2722 (rough estimate) | | refractive index | 1.7380 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Crystalline Powder | | pka | 11.58±0.50(Predicted) | | color | Light yellow to brown-orange | | BRN | 2647 | | InChI | InChI=1S/C4H4N4/c5-1-3-2-7-8-4(3)6/h2H,(H3,6,7,8) | | InChIKey | FFNKBQRKZRMYCL-UHFFFAOYSA-N | | SMILES | N1C=C(C#N)C(N)=N1 | | CAS DataBase Reference | 16617-46-2(CAS DataBase Reference) | | NIST Chemistry Reference | 5-Amino-4-cyano-pyrazole(16617-46-2) | | EPA Substance Registry System | 1H-Pyrazole-4-carbonitrile, 3-amino- (16617-46-2) |
| | 3-Amino-4-pyrazolecarbonitrile Usage And Synthesis |
| Description | The molecular structure of 3-Amino-4-pyrazolecarbonitrile contains a cyano structure and an active amino unit. Its solubility in water is low, but its solubility in alcoholic organic solvents is high. As an intermediate in organic synthesis and medicinal chemistry, 3-Amino-4-pyrazolecarbonitrile can synthesize drug molecules. For example, it can be used to synthesize the drug molecule zaleplon. | | Chemical Properties | Tan Crystalline Solid | | Uses | Building block used in the synthesis of a variety of heterocycles. | | Uses | 3-Amino-4-pyrazolecarbonitrile has been a useful synthetic intermediate. |
| | 3-Amino-4-pyrazolecarbonitrile Preparation Products And Raw materials |
| Preparation Products | 4,6-DICHLORO-1H-PYRAZOLO[3,4-D]PYRIMIDINE-->4-HYDROXY-6-MERCAPTOPYRAZOLO[3,4-D]PYRIMIDINE-->Pyrazolo[1,5-a]pyrimidine-3-carbonitrile, 4,7-dihydro-7-oxo--->5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carbonitrile-->Butanamide, N-(4-cyano-1H-pyrazol-3-yl)--->5-(chloroMethyl)-7-hydroxypyrazolo[1,5-a]pyriMidine-3-carbonitrile |
|