2'-O-MOE-5MeU-3'-phosphoramidite
|
|
2'-O-MOE-5MeU-3'-phosphoramidite 속성
- 산도 계수 (pKa)
- 9.55±0.10(Predicted)
- 물리적 상태
- Solid
- 색상
- White to off-white
- InChIKey
- YFRRKZDUDXHJNC-UHDLEJOUNA-N
- SMILES
- O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C=C(C)C(=O)NC2=O)[C@H](OCCOC)[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |&1:25,27,37,43,r|
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
|
||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | ||||||||||||||
| 유해·위험 문구: |
|
||||||||||||||
| 예방조치문구: |
|
2'-O-MOE-5MeU-3'-phosphoramidite C화학적 특성, 용도, 생산
일반 설명
2'-O-MOE-5MeU-3'-phosphoramidite is a phosphorite monomer that can be used in the synthesis of oligonucleotides.2'-O-MOE-5MeU-3'-phosphoramidite 준비 용품 및 원자재
원자재
준비 용품
2'-O-MOE-5MeU-3'-phosphoramidite 공급 업체
글로벌( 97)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Hefei Huana Biomedical Technology Co.,Ltd. | +86-15900695956 |
shiqin.he@huanaok.com.cn | China | 96 | 58 |
| Shanghai Daken Advanced Materials Co.,Ltd | +86-371-66670886 |
info@dakenam.com | China | 16221 | 58 |
| Shenzhen Nexconn Pharmatechs Ltd | +86-755-89396905 +86-15013857715 |
admin@nexconn.com | China | 10259 | 58 |
| BOC Sciences | +1-631-485-4226 |
inquiry@bocsci.com | United States | 19553 | 58 |
| NewCan Biotech Limited | +86-0571-86912261 +8613735419629 |
sales@newcanbio.com | China | 9980 | 58 |
| Zhejiang Hengkang Pharmaceutical Co., Ltd. | +86-576-83372028 +86-18868723926 |
bd1@hengkangpharm.cn | China | 119 | 58 |
| Wuhu Nuowei chemistry Co., Ltd. | +86-0553-2911116-802 +undefined17756524438 |
sales1@nuowei-chem.com | China | 1640 | 58 |
| Henan Aochuang Chemical Co.,Ltd. | +86-0371-63689365 +8618638391208 |
sales@aochuangchem.com | China | 9425 | 58 |
| Chemtour Biotech Co., Ltd | +8617327281506 |
market@chemtour.com | China | 1460 | 58 |
| SUZHOU SENFEIDA CHEMICAL CO.,LTD | +86-0512-83500002 +8615195660023 |
sales@senfeida.com | China | 10814 | 58 |