|
|
| | 3-Hydroxybutanoic acid calcium salt Basic information | | Appearance |
| Product Name: | 3-Hydroxybutanoic acid calcium salt | | Synonyms: | 3-Hydroxybutanoic acid calcium salt;3-Hydroxybutyric acid calcium salt;3-hydroxybutyrate calcium;Calcium beta-hydroxybutyrate;DL-3-Hydroxybutyrate calcium;Calcium 3-hydroxybutyrate, BHB Ca;Calcium DL -3- Hydroxybutyrate;DL-3-Hydroxybutyrate calcium salt | | CAS: | 586976-56-9 | | MF: | C4H10CaO3 | | MW: | 146.2 | | EINECS: | | | Product Categories: | | | Mol File: | 586976-56-9.mol |  |
| | 3-Hydroxybutanoic acid calcium salt Chemical Properties |
| InChI | InChI=1S/C4H8O3.Ca.2H/c1-3(5)2-4(6)7;;;/h3,5H,2H2,1H3,(H,6,7);;; | | InChIKey | ZBXZMGZNNNMNDK-UHFFFAOYSA-N | | SMILES | C(C(=O)O)C(O)C.[Ca] |
| | 3-Hydroxybutanoic acid calcium salt Usage And Synthesis |
| Appearance |
White solid
| | Chemical Properties | 3-Hydroxybutanoic acid calcium salt, an optically active 3-hydroxybutyric acids are key intermediates of the biosynthesis and metabolism of fatty acids and exist widely in biological systems. | | Uses | 3-Hydroxybutanoic acid calcium salt is used as a nutritional supplement that can increase blood ketone levels, improve athletes' endurance, mental performance and energy levels. |
| | 3-Hydroxybutanoic acid calcium salt Preparation Products And Raw materials |
|