|
| (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Basic information |
| (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Chemical Properties |
Melting point | 149-155 °C(lit.) | storage temp. | Inert atmosphere,2-8°C | solubility | DMSO (Slightly), Water (Slightly) | form | Solid | color | White to Off-White | optical activity | [α]22/D 14°, c = 10 in H2O | Water Solubility | Water: 100 mg/mL (793.08 mM) | BRN | 6118796 | Stability: | Hygroscopic | InChI | InChI=1/C4H8O3.Na.H/c1-3(5)2-4(6)7;;/h3,5H,2H2,1H3,(H,6,7);;/t3-;;/s3 | InChIKey | DIKSWKJUJFMKBT-LPWWCTNINA-N | SMILES | C(C(=O)O)[C@H](O)C.[NaH] |&1:4,r| |
| (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Usage And Synthesis |
Chemical Properties | mp 165-167°C | Uses | Optically active 3-hydroxybutyric acids are key intermediates of the biosynthesis and metabolism of fatty acids and exist widely in biological systems. | Uses | chiral synthon | Uses | (R)-(-)-3-Hydroxybutyric acid sodium salt reacts with crown ether to form a supramolecular complex, which can catalyze the regioselective ring-opening polymerization of (S)-butyrolactone to form (R)-3-hydroxybutyrate oligomers (OHBs). |
| (R)-(-)-3-HYDROXYBUTYRIC ACID, SODIUM SALT Preparation Products And Raw materials |
|