|
|
| | Lercanidipine hydrochloride Basic information |
| Product Name: | Lercanidipine hydrochloride | | Synonyms: | 1,4-dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridinedicarboxylic acid 2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl methyl ester hydrochloride;LERCANIDIPINE HYDROCHLORIDE;1,4-Dihydro-2,6-dimethyl-4-(3-nittrophenyl)-3,5-pyridinedicarboxylicAcid2-[(3,3-Diphenylpropyl)methylamino]-1,1-dimeth;1,4-Dihydro-2,6-dimethyl-4-(3-nittrophenyl)-3,5-pyridinedicarboxylic Acid 2-[(3,3-Diphenylpropyl)methylamino]-1,1-dimethylethyl Methyl Ester Hydrochloride;3-(1-((3,3-Diphenylpropyl)(methyl)amino)-2-methylpropan-2-yl) 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate hydrochloride;3,5-Pyridinedicarboxylicacid, 1,4-dihydro-2,6-diMethyl-4-(3-nitrophenyl)-,3-[2-[(3,3-diphenylpropyl)MethylaMino]-1,1-diMethylethyl] 5-Methyl ester,hydrochloride (1:1);1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-2-[(3,3-diphenylpropyl)methylamino]-1,1-dimethylethyl methyl ester 3,5-pyridinedicarboxylic acid hydrochloride;B-cell CLL/lymphoma 10 | | CAS: | 132866-11-6 | | MF: | C36H42ClN3O6 | | MW: | 648.19 | | EINECS: | 603-682-3 | | Product Categories: | API;Cardiovascular APIs;Aromatics;Dihydropyridine;Heterocycles;Miscellaneous Natural Products;Dihydropyridine Class Chemicals;Intermediates & Fine Chemicals;Pharmaceuticals;Calcium Channel Modulators;Inhibitors and Activators;Voltage-gated Ion Channels | | Mol File: | 132866-11-6.mol |  |
| | Lercanidipine hydrochloride Chemical Properties |
| Melting point | 175-177°C | | storage temp. | 2-8°C | | solubility | Methanol[soluble in] | | solubility | soluble in Methanol | | form | powder | | color | yellow | | Merck | 14,5446 | | InChIKey | WMFYOYKPJLRMJI-UHFFFAOYSA-N | | SMILES | C1(C)NC(C)=C(C(OC(C)(C)CN(CCC(C2=CC=CC=C2)C2=CC=CC=C2)C)=O)C(C2=CC=CC([N+]([O-])=O)=C2)C=1C(OC)=O.[H]Cl | | CAS DataBase Reference | 132866-11-6(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 36/37-45 | | RIDADR | UN 2811 | | WGK Germany | 3 | | HS Code | 2933.39.4100 | | Toxicity | LD50 in mice (mg/kg): 83 i.p.; 657 orally (Nardi) |
| | Lercanidipine hydrochloride Usage And Synthesis |
| Chemical Properties | Pale-Yellow Powder | | Uses | long-acting dihydropyridine calcium channel blocker, antihypertensive | | Uses | A dihydropyridine calcium channel blocker. Antihypertensive. | | Definition | ChEBI: Lercanidipine hydrochloride is a diarylmethane. | | Brand name | Cardiovasc (Recor dati, Italy); Carmen (Recordati, Italy); Corifeo (Recordati,
Italy); Lercadip (Recordati, Italy); Lercan (Recordati,
Italy); Lercapin (Recordati, Italy); Lercaton (Recordati,
Italy); Lerkamen (Recordati, Italy); Lerzam (Recordati,
Italy); Renovia (Recordati, Italy); Vasodip (Recordati,
Italy); Zandip (Recordati, Italy); Zanicor (Recordati, Italy). | | Biological Activity | L-type Ca 2+ channel blocker that displays higher vascular selectivity than Felodipine (4-(2,3-Dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester ). Causes peripheral vasodilation with only weak negative inotropic activity. Antihypertensive. | | Biochem/physiol Actions | Lercanidipine hydrochloride is a L-type (Cav1.2b) vascular channel antagonist; L-type (Cav1.2a) cardiac channel agonist voltage-dependent and highly lipophylic compound, which exhibits a slower onset and longer duration of action than other calcium channel antagonists; an antihypertensive agent in patients with mild-to-moderate hypertension; more vasoselective than lacidipine and amlodipine. |
| | Lercanidipine hydrochloride Preparation Products And Raw materials |
|