|
|
| | 1-Methyl-4-pyrazole boronic acid pinacol ester Basic information |
| Product Name: | 1-Methyl-4-pyrazole boronic acid pinacol ester | | Synonyms: | 1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-;1-METHYL- 4-PYRAZOLEBORONIC ACID PINACOL ESTER;1-METHYL-4-(4,4,5,5-TERAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE;1-methyl-4-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-yl)-1H-;1-Methyl-4-pyrazoleboronic acid pinacol ester, 1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole;1-Methyl-4-(4,4,5-trimethyl-[1,3,2]dioxaborolan-2-yl)-1H-pyrazole;1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97+%;2-(1-Methylpyrazol-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 761446-44-0 | | MF: | C10H17BN2O2 | | MW: | 208.07 | | EINECS: | 616-293-9 | | Product Categories: | Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Heteroaryl Boronate Esters;Organometallic Reagents;Heterocyclic Building Blocks;Organoborons;Pyrazole;Boronic acid | | Mol File: | 761446-44-0.mol |  |
| | 1-Methyl-4-pyrazole boronic acid pinacol ester Chemical Properties |
| Melting point | 59-64 °C(lit.) | | Boiling point | 308.3±15.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (slightly), Methanol (Slightly) | | pka | 2.09±0.10(Predicted) | | form | Crystals | | color | Off-white to yellow | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C10H17BN2O2/c1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8/h6-7H,1-5H3 | | InChIKey | UCNGGGYMLHAMJG-UHFFFAOYSA-N | | SMILES | N1(C)C=C(B2OC(C)(C)C(C)(C)O2)C=N1 | | CAS DataBase Reference | 761446-44-0(CAS DataBase Reference) |
| Hazard Codes | Xn,F,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant/Flammable | | TSCA | No | | HazardClass | IRRITANT | | HS Code | 29349990 |
| | 1-Methyl-4-pyrazole boronic acid pinacol ester Usage And Synthesis |
| Chemical Properties | White to light yellow crystal powde | | Uses | suzuki reaction | | Uses | 1-Methyl-4-pyrazole boronic acid pinacol ester is a reagent used for Suzuki-Miyaura cross-coupling reactions, transesterification reactions. It is involved in several reactions as a reagent for the preparation of aminothiazoles as γ-secretase modulators,amino-pyrido-indol-carboxamides, as potential JAK2 inhibitors for myeloproliferative disorders therapy, pyridine derivatives as TGF-β1 and active A signaling inhibitors and MK-2461 analogs as inhibitors of c-Met kinase for the treatment of cancer. | | Synthesis | To the solution of 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole (0.40 g, 2.06 mmol) in THF (10 mL) was added NaH (0.1.00 g, 4.12 mmol) followed by methyl iodide (0.25 mL, 4.12 mmol) at 0° C and the reaction mixture was stirred at ambient temperature for 4 hr. The reaction was quenched with saturated NH4Cl solution (20 mL) and extracted with ethyl acetate (2 x 50 mL). The combined organic layers were washed with brine (20 mL), dried over sodium sulfate, and distilled under reduced pressure to obtain 1-Methyl-4-pyrazole boronic acid pinacol ester. |
| | 1-Methyl-4-pyrazole boronic acid pinacol ester Preparation Products And Raw materials |
|