|
| Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Basic information |
| Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Chemical Properties |
Melting point | 219-225 °C | storage temp. | -20°C | form | Powder | color | orange | Water Solubility | insoluble | Sensitive | Air Sensitive | InChI | InChI=1S/2C26H24P2.Pd/c2*1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h2*1-20H,21-22H2; | InChIKey | UTBLWXFSGOYWOH-UHFFFAOYSA-R | SMILES | P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1C=CC=CC=1)C1=CC=CC=C1.P(CCP(C1=CC=CC=C1)C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.[Pd] | CAS DataBase Reference | 31277-98-2 |
| Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Usage And Synthesis |
Chemical Properties | yellow to orange crystalline powder | Uses | suzuki reaction |
| Bis[1,2-bis(diphenylphosphino)ethane]palladium(0) Preparation Products And Raw materials |
|