Azido-dPEG4-acid manufacturers
- azido-PEG3-Acid
-
- $0.00 / 10g
-
2024-03-24
- CAS:1056024-94-2
- Min. Order: 10g
- Purity: >98.00%
- Supply Ability: 10g
|
| | Azido-dPEG4-acid Basic information |
| Product Name: | Azido-dPEG4-acid | | Synonyms: | Azido-dPEG4-acid;N3-PEG3-CH2CH2COOH;N3-PEG3-COOH,Azido-PEG3-acid;N3-(CH2)2-O-(CH2-CH2-O)2-(CH2)2-COOH;3-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)propanoicacid/N3-PEG3-CH2CH2COOH;3-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)propanoic acid;N3-PEG3-COOH;N3-PEG3-CH2CH2COOH/Propanoic acid, 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]- | | CAS: | 1056024-94-2 | | MF: | C9H17N3O5 | | MW: | 247.25 | | EINECS: | | | Product Categories: | PROTAC Linker;PROTAC;peg | | Mol File: | 1056024-94-2.mol |  |
| | Azido-dPEG4-acid Chemical Properties |
| solubility | DMSO : 100 mg/mL (404.45 mM; Need ultrasonic) | | form | Liquid | | color | Colorless to light yellow |
| | Azido-dPEG4-acid Usage And Synthesis |
| Description | Azido-PEG3-acid is a crosslinker containing an azide(N3) group with a carboxylic acid (CO2H). The terminal carboxylic acid is reactive with primary amine groups in the presence of activators (e.g. EDC, or HATU) forming a stable amide bond. The azide group enables Click Chemistry. The hydrophilic PEG spacer increases solubility in aqueous media. | | Definition | ChEBI: 3-{2-[2-(2-Azidoethoxy)ethoxy]ethoxy}propanoic acid is an organonitrogen compound. | | Biological Activity | Azido-dPEG4-acid is a PEG-based PROTAC linker for the synthesis of BI-3663 (HY-111546), BI-4216 and BI-0319. It is also a non-cleavable ADC linker containing 3-unit PEG, which can be used to synthesize antibody drug conjugates (ADC). | | in vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. | | target | |
| | Azido-dPEG4-acid Preparation Products And Raw materials |
|