|
| 1 5-DICHLORO-3-PENTANONE Basic information |
Product Name: | 1 5-DICHLORO-3-PENTANONE | Synonyms: | 1 5-DICHLORO-3-PENTANONE;3-PENTANONE, 1,5-DICHLORO- (6CI,7CI,8CI,9CI);3Pentanone1,5Dichloro;1,5-Dichloropentan-3-one;Bis(2-chloroethyl) ketone. 2,2-Dichlorodiethyl ketone;1,5-DichloRopentan-3-one - Technical Grade | CAS: | 3592-25-4 | MF: | C5H8Cl2O | MW: | 155.02 | EINECS: | | Product Categories: | API intermediates | Mol File: | 3592-25-4.mol | ![1 5-DICHLORO-3-PENTANONE Structure](CAS/GIF/3592-25-4.gif) |
| 1 5-DICHLORO-3-PENTANONE Chemical Properties |
Boiling point | 74 °C(Press: 0.8 Torr) | density | 1.183±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | form | liquid | color | Dark brown | InChI | InChI=1S/C5H8Cl2O/c6-3-1-5(8)2-4-7/h1-4H2 | InChIKey | LYJQMHVYFFZQGY-UHFFFAOYSA-N | SMILES | C(Cl)CC(=O)CCCl | CAS DataBase Reference | 3592-25-4(CAS DataBase Reference) |
Hazard Codes | Xi,T | Risk Statements | 25 | Safety Statements | 36-45 | RIDADR | 1993 | HazardClass | 3 | PackingGroup | Ⅲ | HS Code | 2914790090 |
| 1 5-DICHLORO-3-PENTANONE Usage And Synthesis |
Chemical Properties | yellow to light brown liquid |
| 1 5-DICHLORO-3-PENTANONE Preparation Products And Raw materials |
|