|
| Bis(diphenylphosphino)methane Basic information |
| Bis(diphenylphosphino)methane Chemical Properties |
Melting point | 118-119 °C(lit.) | Boiling point | 497.2±28.0 °C(Predicted) | storage temp. | Inert atmosphere,Room Temperature | form | Fine Crystalline Powder | color | Almost white | Water Solubility | Insoluble in water. | Sensitive | Air Sensitive | BRN | 758760 | InChI | InChI=1S/C25H22P2/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2 | InChIKey | XGCDBGRZEKYHNV-UHFFFAOYSA-N | SMILES | C1(C=CC=CC=1)P(CP(C1C=CC=CC=1)C1=CC=CC=C1)C1=CC=CC=C1 | CAS DataBase Reference | 2071-20-7(CAS DataBase Reference) |
| Bis(diphenylphosphino)methane Usage And Synthesis |
Chemical Properties | white to light yellow crystal powde | Uses | It is applied as an organic synthesis catalyst. It is also used as an intermediate in flavor and fragrances. | Uses | suzuki reaction | reaction suitability | reagent type: ligand reaction type: Heck Reaction reagent type: ligand reaction type: Suzuki-Miyaura Coupling |
| Bis(diphenylphosphino)methane Preparation Products And Raw materials |
|