| Company Name: |
Dalian Ruiying Technology Co., Ltd.
|
| Tel: |
0411-86907150 15940963210 |
| Email: |
609262758@qq.com |
| Products Intro: |
Product Name:1-CHLOROBUTANONE
CAS:616-27-3
Purity:95%GC Package:5KG;1KG
|
1-Chlorobutanone manufacturers
- 1-CHLOROBUTANONE
-
- $0.00 / 1kg
-
2024-07-17
- CAS:616-27-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10ton
|
| | 1-Chlorobutanone Basic information |
| Product Name: | 1-Chlorobutanone | | Synonyms: | 1-CHLOROBUTANONE;1-CL-MEK;1-chlorobutan-2-one;1-Chlorobutane-2-one;2-Butanone, 1-chloro-;Serine Impurity 8 | | CAS: | 616-27-3 | | MF: | C4H7ClO | | MW: | 106.55 | | EINECS: | 210-473-7 | | Product Categories: | | | Mol File: | 616-27-3.mol |  |
| | 1-Chlorobutanone Chemical Properties |
| Boiling point | 118.37°C (rough estimate) | | density | 1.0850 | | refractive index | 1.4372 (estimate) | | InChI | InChI=1S/C4H7ClO/c1-2-4(6)3-5/h2-3H2,1H3 | | InChIKey | AALRHBLMAVGWRR-UHFFFAOYSA-N | | SMILES | C(Cl)C(=O)CC | | CAS DataBase Reference | 616-27-3 |
| | 1-Chlorobutanone Usage And Synthesis |
| Uses | 1-Chlorobutan-2-one can be useful in enantioselective and photoenzymic preparation of α-tertiary amines via flavin-dependent ene-reductases catalyzed radical cyclization of oximes. |
| | 1-Chlorobutanone Preparation Products And Raw materials |
|