|
|
| | (Bromoethynyl)triisopropylsilane Basic information |
| Product Name: | (Bromoethynyl)triisopropylsilane | | Synonyms: | 2-bromoethynyl-tri(propan-2-yl)silane;(2-triisopropylsilyl)ethynyl bromide;(2-BROMOETHYNYL)TRIISOPROPYLSILANE;[2-Bromoethynyl]tris[propan-2-yl]silane;Silane, (bromoethynyl)tris(1-methylethyl)-;Silane, (2-bromoethynyl)tris(1-methylethyl)-;Bromoethynyl-triisopropyl-silane;DK970 | | CAS: | 111409-79-1 | | MF: | C11H21BrSi | | MW: | 261.27 | | EINECS: | | | Product Categories: | | | Mol File: | 111409-79-1.mol |  |
| | (Bromoethynyl)triisopropylsilane Chemical Properties |
| Boiling point | 240.5±9.0 °C(Predicted) | | density | 1.073±0.06 g/cm3(Predicted) | | refractive index | 1.49 | | form | clear liquid | | color | Colorless to Red to Green | | InChI | InChI=1S/C11H21BrSi/c1-9(2)13(8-7-12,10(3)4)11(5)6/h9-11H,1-6H3 | | InChIKey | HNNUBQWDWJNURV-UHFFFAOYSA-N | | SMILES | [Si](C#CBr)(C(C)C)(C(C)C)C(C)C | | CAS DataBase Reference | 111409-79-1 |
| | (Bromoethynyl)triisopropylsilane Usage And Synthesis |
| Uses |
(Bromoethynyl)triisopropylsilane could be used as an alkynylating reagen to synthesize the palladium-catalyzed primary amine-directed C(sp2)–H alkynylation of biaryl-2-amines[1].
| | References | [1] Jiang, Guangbin et al. “Palladium-catalyzed primary amine-directed regioselective mono- and di-alkynylation of biaryl-2-amines?.” Chemical Communications 14 (2018): 1746–1749. |
| | (Bromoethynyl)triisopropylsilane Preparation Products And Raw materials |
|