|
|
| | 3-Chloro-1-(N,N-dimethyl)propylamine Basic information |
| Product Name: | 3-Chloro-1-(N,N-dimethyl)propylamine | | Synonyms: | CAS:109-54-6;3-Chloro-1-(N,N-dimethyl)propanamine;dimethylaminopropylchloride;AURORA KA-7644;3-CHLORO-1-(N,N-DIMETHYL)PROPYLAMINE;3-chloropropyl(dimethyl)amine;N-(3-Chloropropyl)-dimethylamine;1-(Dimethylamino)-3-chloropropane | | CAS: | 109-54-6 | | MF: | C5H12ClN | | MW: | 121.61 | | EINECS: | 203-679-3 | | Product Categories: | Polyamines | | Mol File: | 109-54-6.mol |  |
| | 3-Chloro-1-(N,N-dimethyl)propylamine Chemical Properties |
| Melting point | 168℃ | | Boiling point | 140 °C | | density | 0.929 | | refractive index | 1.4320 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | pka | 9.24±0.28(Predicted) | | color | Colorless | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive | | Stability: | Not stable in Solution | | InChI | InChI=1S/C5H12ClN/c1-7(2)5-3-4-6/h3-5H2,1-2H3 | | InChIKey | NYYRRBOMNHUCLB-UHFFFAOYSA-N | | SMILES | C(N(C)C)CCCl | | LogP | 1.244 (est) | | CAS DataBase Reference | 109-54-6(CAS DataBase Reference) |
| RIDADR | 2735 | | HazardClass | 8 | | PackingGroup | Ⅲ |
| | 3-Chloro-1-(N,N-dimethyl)propylamine Usage And Synthesis |
| Chemical Properties | colorless liquid | | Uses | 3-Chloro-1-(N,N-dimethyl)propylamine is a genotoxic impurity in drug samples of rizatriptan benzoate. Also, it is the side chain of Chlorpromazine and Amitriptyline. |
| | 3-Chloro-1-(N,N-dimethyl)propylamine Preparation Products And Raw materials |
| Raw materials | Thionyl chloride-->Dimethylamine-->Allyl alcohol-->1-Bromopropane | | Preparation Products | Citalopram-->Benzydamine hydrochloride-->Melitracen-->4,4-Diethoxy-N,N-dimethyl-1-butanamine-->3,3'-(2,7-DibroMo-9H-fluorene-9,9-diyl)bis(N,N-diMethylpropan- 1-aMine)-->acepromazine-->1-Propanamine, 3,3'-(phenylphosphinidene)bis[N,N-dimethyl--->3-[3-(Dimethylamino)propoxy]benzaldehyde-->N-[3-(2-AMINO-4-CHLOROPHENOXY)PROPYL]-N,N-DIMETHYLAMINE-->Depramine-->[3-(3-CHLORO-9-OXA-1,2,10-TRIAZA-ANTHRACEN-10-YL)-PROPYL]-DIMETHYL-AMINE |
|