- m-PEG8-COOH
-
- $0.00 / 5g
-
2024-03-27
- CAS:1093647-41-6
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | MPEG7-CH2CH2COOH Basic information |
| Product Name: | MPEG7-CH2CH2COOH | | Synonyms: | MPEG7-CH2CH2COOH;4,7,10,13,16,19,22,25-Octaoxahexacosanoic acid;MPEG7-OCH2CH2COOH;mPEG7-propionic acid;mPEG8-COOH;2,5,8,11,14,17,20,23-Octaoxahexacosan-26-oic acid,MeO-(dPEG8)-COOH;m-dPEG8-acid;MeO-(CH2CH2O)7-CH2CH2COOH | | CAS: | 1093647-41-6 | | MF: | C18H36O10 | | MW: | 412.47 | | EINECS: | | | Product Categories: | | | Mol File: | 1093647-41-6.mol |  |
| | MPEG7-CH2CH2COOH Chemical Properties |
| Boiling point | 503.0±50.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | Solid-Liquid Mixture | | color | Colorless to light yellow | | InChI | InChI=1S/C18H36O10/c1-21-4-5-23-8-9-25-12-13-27-16-17-28-15-14-26-11-10-24-7-6-22-3-2-18(19)20/h2-17H2,1H3,(H,19,20) | | InChIKey | JHUSQXBQANBSDC-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOC |
| | MPEG7-CH2CH2COOH Usage And Synthesis |
| Description | m-PEG8-acid is a PEG linker containing a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The hydrophilic PEG spacer increases solubility in aqueous media. | | Uses | m-Peg8 Acid is used in the detection of antibiotic residues by nanogold probe surface plasmon resonance. | | Uses | Applications may include: bioconjugation, drug delivery, PEG hydrogel, crosslinker, and surface functionalization |
| | MPEG7-CH2CH2COOH Preparation Products And Raw materials |
|