- 2-Methyl-5-nitroimidazole
-
- $25.00 / 1ASSAYS
-
2025-04-23
- CAS:88054-22-2
- Min. Order: 100ASSAYS
- Purity: 99.5%
- Supply Ability: 100 mt
|
| | 2-Methyl-5-nitroimidazole Basic information |
| | 2-Methyl-5-nitroimidazole Chemical Properties |
| Melting point | 252 °C | | Boiling point | 0°C | | density | 1.426 | | refractive index | 1.5000 (estimate) | | Fp | 0°C | | storage temp. | Refrigerator | | solubility | Slightly soluble in ethanol, easily soluble in diluted acid and diluted alkali. | | form | Powder | | color | White to beige | | InChI | InChI=1S/C4H5N3O2/c1-3-5-2-4(6-3)7(8)9/h2H,1H3,(H,5,6) | | InChIKey | FFYTTYVSDVWNMY-UHFFFAOYSA-N | | SMILES | C1(C)NC([N+]([O-])=O)=CN=1 | | CAS DataBase Reference | 88054-22-2(CAS DataBase Reference) |
| Risk Statements | 22 | | Safety Statements | 24/25 | | HS Code | 29332900 |
| Provider | Language |
|
ALFA
| English |
| | 2-Methyl-5-nitroimidazole Usage And Synthesis |
| Chemical Properties | 2-Methyl-5-nitroimidazole is white to beige powder | | Uses | 2-Methyl-4(5)-nitroimidazole was used to study the mechanism of both the alkaline and acidic hydrolysis of tinidazole. It is mainly used to synthesize intermediate of medicines such as Metronidazole and dimetridazole. | | Uses | 2-Methyl-5-nitroimidazole (Tinidazole EP Impurity A) is a Floconazole impurity. | | Definition | ChEBI: 2-Methyl-5-nitroimidazole is a C-nitro compound and a member of imidazoles. |
| | 2-Methyl-5-nitroimidazole Preparation Products And Raw materials |
|