|
| 3,5-Dibenzyloxybenzyl alcohol Basic information |
| 3,5-Dibenzyloxybenzyl alcohol Chemical Properties |
Melting point | 78-81 °C (lit.) | Boiling point | 419.27°C (rough estimate) | density | 1.1063 (rough estimate) | refractive index | 1.6000 (estimate) | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Slightly), Methanol (Slightly) | pka | 14.22±0.10(Predicted) | form | Crystals or Needles | color | White to off-white | InChI | InChI=1S/C21H20O3/c22-14-19-11-20(23-15-17-7-3-1-4-8-17)13-21(12-19)24-16-18-9-5-2-6-10-18/h1-13,22H,14-16H2 | InChIKey | MHHXKZKHZMSINU-UHFFFAOYSA-N | SMILES | C1(CO)=CC(OCC2=CC=CC=C2)=CC(OCC2=CC=CC=C2)=C1 | CAS DataBase Reference | 24131-31-5(CAS DataBase Reference) |
Safety Statements | 24/25 | WGK Germany | 3 | HS Code | 29094990 |
| 3,5-Dibenzyloxybenzyl alcohol Usage And Synthesis |
Chemical Properties | white to off-white crystals or needles |
| 3,5-Dibenzyloxybenzyl alcohol Preparation Products And Raw materials |
|