|
|
| | 2-Chloro-4-fluorobenzoic acid Basic information |
| | 2-Chloro-4-fluorobenzoic acid Chemical Properties |
| Melting point | 181-183 °C (lit.) | | Boiling point | 271.9±20.0 °C(Predicted) | | density | 1.4016 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | 95% ethanol: soluble50mg/mL, clear to very slightly hazy, colorless to very faintly yellow | | form | Powder or Flakes | | pka | 2.90±0.25(Predicted) | | color | White | | BRN | 1946215 | | InChI | InChI=1S/C7H4ClFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) | | InChIKey | GRPWQLDSGNZEQE-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(F)C=C1Cl | | CAS DataBase Reference | 2252-51-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Chloro-4-fluorobenzoic acid(2252-51-9) | | EPA Substance Registry System | Benzoic acid, 2-chloro-4-fluoro- (2252-51-9) |
| | 2-Chloro-4-fluorobenzoic acid Usage And Synthesis |
| Chemical Properties | Powder or crystalline or flakes | | Uses | 2-Chloro-4-fluorobenzoic acid was used in the preparation of 2-(2-chloro-4-fluorophenyl)-benzothiazole. | | Application | 2-Chloro-4-fluorobenzoic acid can be used as:
(1) Studies on the preparation, luminescence and thermal properties of lanthanide complexes of 2-chloro-4-fluorobenzoic acid.
(2) Preparation, crystal structure, thermal and fluorescence property studies of rare earth complexes composed with 2,2':6′,2″-tripyridine.
(3) Analysis of charge density of intermolecular interactions between isohalogen (Cl--F) and homohalogen (F--F) molecules in molecular crystals. Attractive intermolecular Cl--F interactions (type II interactions) in 2-chloro-4-fluorobenzoic acid. |
| | 2-Chloro-4-fluorobenzoic acid Preparation Products And Raw materials |
|