|
|
| | L-NORADRENALINE BITARTRATE Basic information |
| | L-NORADRENALINE BITARTRATE Chemical Properties |
| Melting point | 100-104 °C(lit.) | | refractive index | -11 ° (C=5, H2O) | | storage temp. | Refrigerator | | solubility | H2O: soluble50mg/mL, clear | | pka | 8.64(at 25℃) | | form | solid | | color | white | | optical activity | [α]20/D 11.5±1°, c = 2% in H2O | | Water Solubility | water: 1mg/mL | | BRN | 4078502 | | InChI | InChI=1/C8H11NO3.C4H6O6/c9-4-8(12)5-1-2-6(10)7(11)3-5;5-1(3(7)8)2(6)4(9)10/h1-3,8,10-12H,4,9H2;1-2,5-6H,(H,7,8)(H,9,10)/t8-;1-,2-/s3 | | InChIKey | WNPNNLQNNJQYFA-KBOIKTAVNA-N | | SMILES | [C@H](C1C=CC(O)=C(O)C=1)(O)CN.[C@H](O)(C(=O)O)[C@@H](O)C(=O)O |&1:0,12,17,r| |
| | L-NORADRENALINE BITARTRATE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Demethylated precursor of epinephrine (adrenaline). It is a sympathomimetic hormone produced by the adrenal gland. | | Uses | A demethylated precursor of epinephrine. | | Uses | Noradrenaline bitartrate monohydrate (Levophed) is a direct alpha-adrenergic receptors stimulator.
Noradrenaline bitartrate monohydrate (Levophed) also directly stimulates the beta-adrenergic receptors of the heart (beta1-adrenergic receptors), but not th | | Biochem/physiol Actions | Norepinephrine bitartrate plays an important role in in vivo and in vitro development of pathogenic and indigenous bacteria. It acts as a vasoconstrictor and adrenergic neurotransmitter. |
| | L-NORADRENALINE BITARTRATE Preparation Products And Raw materials |
|