- Caronic anhydride
-
- $0.00 / 1kg
-
2024-07-22
- CAS:67911-21-1
- Min. Order: 0.10000000149011612kg
- Purity: 99
- Supply Ability: 20tons
- Caronic anhydride
-
- $0.00 / 1g
-
2024-04-07
- CAS:67911-21-1
- Min. Order: 1g
- Purity: 99.99%
- Supply Ability: 20 tons
|
| | Caronic anhydride Basic information |
| Product Name: | Caronic anhydride | | Synonyms: | caronic anhydride;6,6-Dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione caronic anhydride aronicanhydride;3-Oxabicyclo[3.1.0]hexane-2,4-dione,6,6-diMethyl-;6,6-Dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione (Caronic anhydride);6,6-dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-quinone;6,6-Dimethyl-3-oxabicyclo[3.1.]hexane-2,4-dione;Caronic anhydride(Cas number:67911-21-1);Caronic Anhydride > | | CAS: | 67911-21-1 | | MF: | C7H8O3 | | MW: | 140.14 | | EINECS: | | | Product Categories: | API;1;3;67911-21-1 | | Mol File: | 67911-21-1.mol |  |
| | Caronic anhydride Chemical Properties |
| Melting point | 53-57℃ | | Boiling point | 246°C | | density | 1.274 | | Fp | 113°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | Solid | | color | White | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C7H8O3/c1-7(2)3-4(7)6(9)10-5(3)8/h3-4H,1-2H3 | | InChIKey | QKAHKEDLPBJLFD-UHFFFAOYSA-N | | SMILES | C12C(C1(C)C)C(=O)OC2=O | | CAS DataBase Reference | 67911-21-1(CAS DataBase Reference) |
| HazardClass | IRRITANT | | HS Code | 2914199090 |
| | Caronic anhydride Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses |
Caronic anhydride, also known as 6,6-Dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione, is a pharmaceutical intermediate mainly used as a synthesis of Boceprevir, an oral protease inhibitor of hepatitis C. It is widely used in agricultural chemicals and other organic synthesis field.
|
| | Caronic anhydride Preparation Products And Raw materials |
|