|
| 6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir Key interMediate Basic information | Physical Form |
| 6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir Key interMediate Chemical Properties |
Boiling point | 135℃ | density | 0.911 | Fp | 24℃ | storage temp. | 2-8°C(protect from light) | pka | 11.51±0.40(Predicted) | InChI | InChI=1S/C7H13N/c1-7(2)5-3-8-4-6(5)7/h5-6,8H,3-4H2,1-2H3 | InChIKey | BGOMFPZIMJCRDV-UHFFFAOYSA-N | SMILES | C12C(C1(C)C)CNC2 |
RIDADR | 1993 | HazardClass | 3 | PackingGroup | Ⅱ | HS Code | 2933998090 |
| 6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir Key interMediate Usage And Synthesis |
Physical Form | Liquid | Uses | 6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir is a Key interMediate. |
| 6,6-DiMethyl-3-azabicyclo[3.1.0]hexane Boceprevir Key interMediate Preparation Products And Raw materials |
|