|
|
| | tert-Butylperoxy 2-ethylhexyl carbonate Basic information |
| Product Name: | tert-Butylperoxy 2-ethylhexyl carbonate | | Synonyms: | LUPEROX TBEC;Ο,Ο-tert-Butyl Ο-(2-ethylhexyl)peroxy carbonate;tert-Butylperoxy 2-ethylhexyl carbonate (Luperox(R) TBEC);Carbonoperoxoicacid,OO-(1,1-dimethylethyl)O-(2-ethylhexyl)ester;Trigonox 117;TERT-BUTYLPEROXY 2-ETHYLHEXYL CARBONATE;OO-tert-butyl O-(2-ethylhexyl) peroxycarbonate;t-Butyl peroxy 2-ethylhexyl monocarbonate | | CAS: | 34443-12-4 | | MF: | C13H26O4 | | MW: | 246.34 | | EINECS: | 252-029-5 | | Product Categories: | | | Mol File: | 34443-12-4.mol |  |
| | tert-Butylperoxy 2-ethylhexyl carbonate Chemical Properties |
| Melting point | -50 °C | | Boiling point | 309.35°C (rough estimate) | | density | 0.927 g/mL at 25 °C(lit.) | | vapor pressure | 1Pa at 25℃ | | refractive index | n20/D 1.428(lit.) | | Fp | 214 °F | | storage temp. | Refrigerator (+4°C) | | Water Solubility | 5.39mg/L at 20.3℃ | | InChI | InChI=1S/C13H26O4/c1-6-8-9-11(7-2)10-15-12(14)16-17-13(3,4)5/h11H,6-10H2,1-5H3 | | InChIKey | BRQMAAFGEXNUOL-UHFFFAOYSA-N | | SMILES | C(OOC(C)(C)C)(OCC(CC)CCCC)=O | | LogP | 5.2 at 25℃ | | EPA Substance Registry System | tert-Butylperoxy 2-ethylhexyl carbonate (34443-12-4) |
| | tert-Butylperoxy 2-ethylhexyl carbonate Usage And Synthesis |
| Chemical Properties | clear liquid | | Uses | Polymerization initiator |
| | tert-Butylperoxy 2-ethylhexyl carbonate Preparation Products And Raw materials |
|