|
| 2,6-DICHLORO-5-FLUORONICOTINAMIDE Basic information |
Product Name: | 2,6-DICHLORO-5-FLUORONICOTINAMIDE | Synonyms: | 3-PyridinecarboxaMide, 2,6-dichloro-5-fluoro-;2,6-Dichloro-5-fluoronicotinamide97%;2,6-DICHLORO-5-FLUORONICOTINAMIDE;2,6-Dichloro-5-fluoronicotinamide 97%;CPD2809-A1;2,6-DICHLORO-5-FLUORONICOTIMIDE;2,6-dichloro-3-carboxamide-5-fluoropyridine;2,6-DICHLORO-5-FLUORONICOTINAMIDE ISO 9001:2015 REACH | CAS: | 113237-20-0 | MF: | C6H3Cl2FN2O | MW: | 209.01 | EINECS: | | Product Categories: | 113237-20-0 | Mol File: | 113237-20-0.mol | |
| 2,6-DICHLORO-5-FLUORONICOTINAMIDE Chemical Properties |
Melting point | 160-162 | Boiling point | 259.0±40.0 °C(Predicted) | density | 1.614±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | form | crystalline solid | pka | 13.36±0.50(Predicted) | color | White | InChI | InChI=1S/C6H3Cl2FN2O/c7-4-2(6(10)12)1-3(9)5(8)11-4/h1H,(H2,10,12) | InChIKey | ZVYNUGSPFZCYEV-UHFFFAOYSA-N | SMILES | C1(Cl)=NC(Cl)=C(F)C=C1C(N)=O |
Hazard Codes | Xi | Hazard Note | Irritant | HS Code | 2933399990 |
| 2,6-DICHLORO-5-FLUORONICOTINAMIDE Usage And Synthesis |
Uses | 2,6-Dichloro-5-fluoronicotinamide is a fluorinated pharmaceutical intermediate compound used in the synthesis of Sotorasib and AMG 510. Sotorasib is a RAS GTPase family inhibitor used for the treatment of KRAS-mutated solid tumours including non-small cell lung cancer (NSCLC) and colorectal cancer. |
| 2,6-DICHLORO-5-FLUORONICOTINAMIDE Preparation Products And Raw materials |
|